/*
Theme Name: NFS Reference
Theme URI: https://naturalfoodseries.com/
Author: Blackcedar Media Limited
Author URI: https://naturalfoodseries.com/
Description: A lightweight, editorial reference theme built for Natural Food Series. Optimized for evergreen food, nutrition, wellness, essential-oil, beverage and natural-beauty content with strong semantic structure, accessibility and performance.
Version: 1.1.1
Requires at least: 6.4
Tested up to: 6.8
Requires PHP: 8.0
License: GNU General Public License v2 or later
License URI: https://www.gnu.org/licenses/gpl-2.0.html
Text Domain: nfs-reference
Tags: blog, news, accessibility-ready, custom-logo, custom-menu, featured-images, threaded-comments, translation-ready
*/

:root {
  --nfs-bg: #fbfaf5;
  --nfs-surface: #ffffff;
  --nfs-surface-soft: #f2f5ed;
  --nfs-ink: #17211b;
  --nfs-muted: #5d695f;
  --nfs-border: #dfe5dc;
  --nfs-green: #1f5a3c;
  --nfs-green-dark: #143c29;
  --nfs-green-soft: #e4eee5;
  --nfs-sage: #7e987d;
  --nfs-gold: #a4792b;
  --nfs-warning: #7a4d12;
  --nfs-danger: #8c322c;
  --nfs-success: #2e6848;
  --nfs-radius-sm: 8px;
  --nfs-radius: 14px;
  --nfs-radius-lg: 22px;
  --nfs-shadow: 0 12px 32px rgba(20, 60, 41, .07);
  --nfs-content: 760px;
  --nfs-wide: 1180px;
  --nfs-header-h: 72px;
  --nfs-ui-font: ui-sans-serif, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Helvetica, Arial, sans-serif;
  --nfs-heading-font: Georgia, "Times New Roman", serif;
  --nfs-article-heading-font: ui-sans-serif, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Helvetica, Arial, sans-serif;
  --nfs-content-font: Georgia, "Times New Roman", serif;
  --nfs-h1-size: 58px;
  --nfs-h2-size: 32px;
  --nfs-h3-size: 23px;
  --nfs-h4-size: 19px;
  --nfs-content-size: 17px;
  --nfs-content-line-height: 1.76;
  --nfs-hero-width: 920px;
  --nfs-hero-max-height: 400px;
}

* { box-sizing: border-box; }
html { scroll-behavior: smooth; text-size-adjust: 100%; }
body {
  margin: 0;
  background: var(--nfs-bg);
  color: var(--nfs-ink);
  font-family: var(--nfs-ui-font);
  font-size: 17px;
  line-height: 1.7;
  -webkit-font-smoothing: antialiased;
}
img { max-width: 100%; height: auto; }
figure { margin: 0; }
a { color: var(--nfs-green); text-decoration-thickness: .08em; text-underline-offset: .18em; }
a:hover { color: var(--nfs-green-dark); }
button, input, select, textarea { font: inherit; }
button, input[type="submit"] { cursor: pointer; }
:focus-visible { outline: 3px solid #b18a3c; outline-offset: 3px; }
::selection { background: #dbe9dc; color: var(--nfs-ink); }

.nfs-shell { width: min(calc(100% - 40px), var(--nfs-wide)); margin-inline: auto; }
.nfs-content-width { width: min(calc(100% - 40px), var(--nfs-content)); margin-inline: auto; }
.nfs-sr-only {
  position: absolute !important; width: 1px; height: 1px; padding: 0; margin: -1px;
  overflow: hidden; clip: rect(0,0,0,0); white-space: nowrap; border: 0;
}
.nfs-kicker { margin: 0 0 8px; color: var(--nfs-green); font-size: .76rem; font-weight: 800; letter-spacing: .1em; text-transform: uppercase; }
.nfs-muted { color: var(--nfs-muted); }

/* Header */
.site-header {
  position: sticky; top: 0; z-index: 100;
  min-height: var(--nfs-header-h);
  background: rgba(251,250,245,.96);
  border-bottom: 1px solid rgba(31,90,60,.12);
  backdrop-filter: blur(12px);
}
.admin-bar .site-header { top: 32px; }
.nfs-header-inner { min-height: var(--nfs-header-h); display: flex; align-items: center; gap: 24px; }
.site-branding { display: flex; align-items: center; flex: 0 0 auto; }
.custom-logo-link { display: inline-flex; align-items: center; }
.custom-logo { width: auto; max-height: 48px; }
.nfs-wordmark { display: inline-flex; align-items: center; gap: 10px; color: var(--nfs-green-dark); text-decoration: none; font-weight: 850; letter-spacing: -.03em; font-size: 1.15rem; }
.nfs-wordmark svg { width: 31px; height: 31px; }
.nfs-primary-nav { margin-left: auto; }
.nfs-primary-nav ul { list-style: none; padding: 0; margin: 0; display: flex; align-items: center; gap: 5px; }
.nfs-primary-nav a { display: block; padding: 10px 9px; color: var(--nfs-ink); text-decoration: none; font-size: .89rem; font-weight: 650; border-radius: 8px; }
.nfs-primary-nav a:hover, .nfs-primary-nav .current-menu-item > a { color: var(--nfs-green); background: var(--nfs-green-soft); }
.nfs-header-actions { display: flex; align-items: center; gap: 8px; }
.nfs-icon-button { border: 1px solid var(--nfs-border); background: var(--nfs-surface); color: var(--nfs-ink); border-radius: 10px; width: 42px; height: 42px; display: inline-grid; place-items: center; }
.nfs-icon-button:hover { border-color: var(--nfs-sage); background: var(--nfs-surface-soft); }
.nfs-menu-toggle { display: none; }
.nfs-search-panel { display: none; padding: 16px 0 20px; border-top: 1px solid var(--nfs-border); }
.nfs-search-panel.is-open { display: block; }
.nfs-search-form { display: flex; gap: 10px; width: min(760px, 100%); }
.nfs-search-form label { flex: 1; }
.nfs-search-form input[type="search"] { width: 100%; min-height: 48px; border: 1px solid var(--nfs-border); border-radius: 10px; padding: 0 15px; background: var(--nfs-surface); color: var(--nfs-ink); }
.nfs-search-form button { border: 0; border-radius: 10px; padding: 0 20px; background: var(--nfs-green); color: #fff; font-weight: 750; }

/* Hero */
.nfs-home-hero { padding: clamp(54px, 8vw, 108px) 0 clamp(48px, 6vw, 78px); background: radial-gradient(circle at 85% 10%, #e4eee5 0, rgba(228,238,229,0) 34%); border-bottom: 1px solid var(--nfs-border); }
.nfs-home-hero__grid { display: grid; grid-template-columns: minmax(0, 1.2fr) minmax(280px, .8fr); gap: clamp(36px, 7vw, 92px); align-items: center; }
.nfs-home-hero h1 { margin: 0 0 18px; max-width: 760px; font-family: var(--nfs-heading-font); font-size: clamp(2.25rem, 5vw, var(--nfs-h1-size)); line-height: 1.02; letter-spacing: -.045em; font-weight: 700; }
.nfs-home-hero p { margin: 0 0 28px; max-width: 680px; font-size: clamp(1.08rem, 2vw, 1.28rem); color: var(--nfs-muted); }
.nfs-home-search { padding: 9px; border: 1px solid #cfd9cf; border-radius: 15px; background: rgba(255,255,255,.9); box-shadow: var(--nfs-shadow); }
.nfs-home-search .nfs-search-form { width: 100%; }
.nfs-home-search input[type="search"] { border: 0; background: transparent; min-height: 54px; }
.nfs-home-search button { min-width: 108px; }
.nfs-hero-note { display: flex; align-items: center; gap: 8px; margin-top: 14px !important; font-size: .82rem !important; color: var(--nfs-muted); }
.nfs-hero-orbit { position: relative; aspect-ratio: 1; min-height: 340px; }
.nfs-orbit-center { position: absolute; inset: 24% 24%; border-radius: 50%; background: var(--nfs-green-dark); color: white; display: grid; place-items: center; text-align: center; padding: 28px; box-shadow: 0 25px 60px rgba(20,60,41,.18); }
.nfs-orbit-center strong { font-family: Georgia, serif; font-size: clamp(1.2rem, 2.5vw, 1.75rem); line-height: 1.15; }
.nfs-orbit-pill { position: absolute; padding: 10px 14px; background: #fff; border: 1px solid var(--nfs-border); border-radius: 999px; box-shadow: var(--nfs-shadow); font-size: .82rem; font-weight: 750; white-space: nowrap; }
.nfs-orbit-pill:nth-child(2) { top: 7%; left: 35%; }
.nfs-orbit-pill:nth-child(3) { top: 31%; right: 1%; }
.nfs-orbit-pill:nth-child(4) { bottom: 12%; right: 19%; }
.nfs-orbit-pill:nth-child(5) { bottom: 10%; left: 8%; }
.nfs-orbit-pill:nth-child(6) { top: 33%; left: 0; }

/* Sections */
.nfs-section { padding: clamp(52px, 7vw, 84px) 0; }
.nfs-section + .nfs-section { border-top: 1px solid var(--nfs-border); }
.nfs-section--surface { background: var(--nfs-surface); }
.nfs-section-head { display: flex; align-items: end; justify-content: space-between; gap: 24px; margin-bottom: 28px; }
.nfs-section-head h2 { margin: 0; font-family: var(--nfs-heading-font); font-size: clamp(1.5rem, 3vw, var(--nfs-h2-size)); line-height: 1.1; letter-spacing: -.03em; }
.nfs-section-head p { max-width: 620px; margin: 8px 0 0; color: var(--nfs-muted); }
.nfs-section-link { flex: 0 0 auto; font-weight: 750; text-decoration: none; }

.nfs-topic-grid { display: grid; grid-template-columns: repeat(5, 1fr); gap: 14px; }
.nfs-topic-card { min-height: 176px; padding: 22px; border: 1px solid var(--nfs-border); border-radius: var(--nfs-radius); background: var(--nfs-surface); text-decoration: none; color: var(--nfs-ink); transition: transform .18s ease, border-color .18s ease, box-shadow .18s ease; }
.nfs-topic-card:hover { transform: translateY(-3px); border-color: #b9c8b9; box-shadow: var(--nfs-shadow); color: var(--nfs-ink); }
.nfs-topic-icon { width: 38px; height: 38px; border-radius: 50%; display: grid; place-items: center; margin: 0 0 28px; padding: 0; background: var(--nfs-green-soft); color: var(--nfs-green-dark); font-weight: 850; line-height: 1; text-align: center; }
.nfs-topic-card strong { display: block; font-size: 1.04rem; line-height: 1.3; }
.nfs-topic-card > span:not(.nfs-topic-icon) { display: block; margin-top: 6px; color: var(--nfs-muted); font-size: .84rem; line-height: 1.45; }

.nfs-goal-grid { display: grid; grid-template-columns: repeat(4, 1fr); gap: 12px; }
.nfs-goal { padding: 15px 17px; display: flex; align-items: center; justify-content: space-between; gap: 12px; border: 1px solid var(--nfs-border); border-radius: 12px; background: var(--nfs-surface); color: var(--nfs-ink); text-decoration: none; font-weight: 700; }
.nfs-goal:hover { background: var(--nfs-green-soft); color: var(--nfs-green-dark); }
.nfs-goal span:last-child { color: var(--nfs-muted); font-size: .82rem; font-weight: 600; }

/* Article cards */
.nfs-card-grid { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 28px; }
.nfs-card { min-width: 0; }
.nfs-card__image { display: block; position: relative; aspect-ratio: 16/10; overflow: hidden; border-radius: var(--nfs-radius); background: #e7ebe5; }
.nfs-card__image img { width: 100%; height: 100%; object-fit: cover; transition: transform .3s ease; }
.nfs-card:hover .nfs-card__image img { transform: scale(1.025); }
.nfs-card__placeholder { width: 100%; height: 100%; display: grid; place-items: center; background: linear-gradient(135deg, #e4eee5, #f4efe2); color: var(--nfs-green); font-family: Georgia, serif; font-size: 1.8rem; }
.nfs-card__body { padding-top: 16px; }
.nfs-card__meta { display: flex; flex-wrap: wrap; gap: 7px 12px; margin-bottom: 8px; color: var(--nfs-muted); font-size: .76rem; font-weight: 650; }
.nfs-card__meta a { color: var(--nfs-green); text-decoration: none; }
.nfs-card h3, .nfs-card h2 { margin: 0; font-family: Georgia, "Times New Roman", serif; font-size: clamp(1.32rem, 2.2vw, 1.65rem); line-height: 1.2; letter-spacing: -.02em; }
.nfs-card h3 a, .nfs-card h2 a { color: var(--nfs-ink); text-decoration: none; }
.nfs-card h3 a:hover, .nfs-card h2 a:hover { color: var(--nfs-green); }
.nfs-card__excerpt { margin: 10px 0 0; color: var(--nfs-muted); font-size: .91rem; line-height: 1.6; }
.nfs-card--featured { display: grid; grid-template-columns: minmax(0,1.3fr) minmax(260px,.7fr); gap: 32px; align-items: center; }
.nfs-card--featured .nfs-card__image { aspect-ratio: 16/9; }
.nfs-card--featured h2 { font-size: clamp(2rem, 4vw, 3.25rem); }

/* Archive */
.nfs-archive-hero { padding: clamp(48px, 7vw, 82px) 0 34px; }
.nfs-breadcrumbs { display: flex; flex-wrap: wrap; gap: 6px; margin: 0 0 17px; color: var(--nfs-muted); font-size: .79rem; }
.nfs-breadcrumbs a { color: var(--nfs-muted); text-decoration: none; }
.nfs-breadcrumbs a:hover { color: var(--nfs-green); }
.nfs-archive-hero h1 { margin: 0; max-width: 920px; font-family: var(--nfs-heading-font); font-size: clamp(2.25rem, 5vw, var(--nfs-h1-size)); line-height: 1.03; letter-spacing: -.045em; }
.nfs-archive-description { max-width: 760px; margin-top: 18px; color: var(--nfs-muted); font-size: 1.08rem; }
.nfs-child-topics { display: flex; gap: 8px; flex-wrap: wrap; margin-top: 24px; }
.nfs-child-topics a { padding: 8px 12px; border: 1px solid var(--nfs-border); border-radius: 999px; background: var(--nfs-surface); color: var(--nfs-ink); font-size: .82rem; font-weight: 700; text-decoration: none; }
.nfs-child-topics a:hover { background: var(--nfs-green-soft); color: var(--nfs-green-dark); }
.nfs-archive-content { padding: 22px 0 80px; }
.nfs-pagination { margin-top: 50px; }
.nfs-pagination .nav-links { display: flex; gap: 7px; flex-wrap: wrap; }
.nfs-pagination a, .nfs-pagination span { min-width: 42px; min-height: 42px; padding: 8px 12px; display: grid; place-items: center; border: 1px solid var(--nfs-border); border-radius: 9px; background: var(--nfs-surface); text-decoration: none; color: var(--nfs-ink); }
.nfs-pagination .current { background: var(--nfs-green); color: white; border-color: var(--nfs-green); }

/* Single article */
.nfs-article-header { padding: clamp(42px, 6vw, 76px) 0 30px; }
.nfs-article-header__inner { width: min(calc(100% - 40px), 980px); margin-inline: auto; }
.nfs-article-header h1 { margin: 0; font-family: var(--nfs-heading-font); font-size: clamp(2.25rem, 4.6vw, var(--nfs-h1-size)); line-height: 1.03; letter-spacing: -.045em; text-wrap: balance; }
.nfs-article-deck { max-width: 820px; margin: 22px 0 0; color: var(--nfs-muted); font-size: clamp(1.08rem, 2vw, 1.3rem); line-height: 1.6; }
.nfs-byline { display: flex; flex-wrap: wrap; align-items: center; gap: 8px 12px; margin-top: 23px; color: var(--nfs-muted); font-size: .84rem; }
.nfs-byline a { font-weight: 750; text-decoration: none; }
.nfs-byline__dot::before { content: "•"; margin-right: 12px; color: #a8b0a8; }
.nfs-article-hero { width: min(calc(100% - 40px), 1080px); margin: 18px auto 0; text-align: left; }
.nfs-article-hero img { display: block; width: min(100%, 740px); max-width: 100%; height: auto; max-height: var(--nfs-hero-max-height); margin: 0; object-fit: contain; border-radius: var(--nfs-radius-lg); background: var(--nfs-surface); }
.nfs-article-hero figcaption { width: min(100%, 740px); padding: 8px 4px; color: var(--nfs-muted); font-size: .75rem; text-align: center; }
.nfs-article-layout { width: min(calc(100% - 40px), 1080px); margin: 38px auto 0; display: grid; grid-template-columns: minmax(0, 740px) minmax(220px, 280px); gap: 56px; align-items: start; }
.nfs-article-main { min-width: 0; }
.nfs-article-sidebar { position: sticky; top: calc(var(--nfs-header-h) + 28px); }
.admin-bar .nfs-article-sidebar { top: calc(var(--nfs-header-h) + 60px); }
.nfs-sidebar-label { margin: 0 0 10px; color: var(--nfs-muted); font-size: .72rem; font-weight: 800; text-transform: uppercase; letter-spacing: .08em; }

.nfs-quick-answer { margin: 0 0 28px; padding: 22px 24px; background: var(--nfs-green-soft); border-left: 4px solid var(--nfs-green); border-radius: 0 var(--nfs-radius) var(--nfs-radius) 0; }
.nfs-quick-answer strong { display: block; margin-bottom: 6px; color: var(--nfs-green-dark); font-size: .8rem; text-transform: uppercase; letter-spacing: .08em; }
.nfs-quick-answer p { margin: 0; }
.nfs-key-facts { margin: 0 0 32px; padding: 22px; border: 1px solid var(--nfs-border); border-radius: var(--nfs-radius); background: var(--nfs-surface); }
.nfs-key-facts h2 { margin: 0 0 14px !important; font-family: inherit !important; font-size: 1rem !important; line-height: 1.2 !important; letter-spacing: 0 !important; }
.nfs-key-facts dl { margin: 0; display: grid; grid-template-columns: repeat(2, minmax(0,1fr)); gap: 14px 24px; }
.nfs-key-facts dt { color: var(--nfs-muted); font-size: .72rem; font-weight: 800; text-transform: uppercase; letter-spacing: .06em; }
.nfs-key-facts dd { margin: 2px 0 0; font-size: .92rem; font-weight: 650; }
.nfs-evidence-badge { display: inline-flex; padding: 5px 9px; border-radius: 999px; background: var(--nfs-green-soft); color: var(--nfs-green-dark); font-size: .72rem; font-weight: 800; }

.nfs-toc { margin: 0; padding: 18px 18px 16px; border: 1px solid var(--nfs-border); border-radius: var(--nfs-radius); background: var(--nfs-surface); }
.nfs-toc__title { margin: 0 0 10px; font-size: .86rem; font-weight: 800; }
.nfs-toc ol { margin: 0; padding-left: 18px; }
.nfs-toc li { margin: 7px 0; color: var(--nfs-muted); font-size: .8rem; line-height: 1.35; }
.nfs-toc li.nfs-toc-h3 { margin-left: 10px; font-size: .76rem; }
.nfs-toc a { color: var(--nfs-muted); text-decoration: none; }
.nfs-toc a:hover { color: var(--nfs-green); }

.entry-content { font-family: var(--nfs-content-font); font-size: var(--nfs-content-size); line-height: var(--nfs-content-line-height); color: #202720; }
.entry-content > *:first-child { margin-top: 0; }
.entry-content p { margin: 0 0 1.35em; }
.entry-content h2 { margin: 2.05em 0 .62em; color: var(--nfs-ink); font-family: var(--nfs-article-heading-font); font-size: var(--nfs-h2-size); line-height: 1.16; letter-spacing: -.025em; scroll-margin-top: 110px; }
.entry-content h3 { margin: 1.65em 0 .52em; color: var(--nfs-ink); font-family: var(--nfs-article-heading-font); font-size: var(--nfs-h3-size); line-height: 1.22; letter-spacing: -.015em; scroll-margin-top: 110px; }
.entry-content h4 { margin: 1.5em 0 .45em; font-family: var(--nfs-article-heading-font); font-size: var(--nfs-h4-size); line-height: 1.28; }
.entry-content ul, .entry-content ol { margin: 0 0 1.35em; padding-left: 1.25em; }
.entry-content li { margin: .42em 0; }
.entry-content blockquote { margin: 1.8em 0; padding: 1px 0 1px 24px; border-left: 3px solid var(--nfs-sage); color: #3d4b40; font-size: 1.08em; }
.entry-content table { width: 100%; border-collapse: collapse; margin: 1.7em 0; font-family: ui-sans-serif, -apple-system, BlinkMacSystemFont, "Segoe UI", sans-serif; font-size: .88rem; line-height: 1.5; background: var(--nfs-surface); }
.entry-content th, .entry-content td { padding: 12px 14px; border: 1px solid var(--nfs-border); text-align: left; vertical-align: top; }
.entry-content th { background: var(--nfs-surface-soft); color: var(--nfs-green-dark); font-weight: 800; }
.entry-content figure { margin: 1.9em 0; }
.entry-content figcaption { margin-top: 8px; color: var(--nfs-muted); font-family: ui-sans-serif, sans-serif; font-size: .72rem; }
.entry-content img { border-radius: var(--nfs-radius); }
.entry-content .wp-block-separator { border: 0; border-top: 1px solid var(--nfs-border); margin: 2.3em 0; }
.entry-content .alignwide { width: min(960px, 100vw - 40px); max-width: none; margin-left: 50%; transform: translateX(-50%); }
.entry-content .alignfull { width: 100vw; max-width: none; margin-left: 50%; transform: translateX(-50%); }

.nfs-safety-note { margin: 32px 0; padding: 20px 22px; border: 1px solid #dbc8aa; border-radius: var(--nfs-radius); background: #fbf4e7; font-family: ui-sans-serif, sans-serif; font-size: .9rem; }
.nfs-safety-note strong { color: var(--nfs-warning); }
.nfs-affiliate-slot { margin: 32px 0; }
.nfs-products { display: grid; grid-template-columns: repeat(3, minmax(0,1fr)); gap: 12px; font-family: ui-sans-serif, sans-serif; }
.nfs-product { padding: 14px; border: 1px solid var(--nfs-border); border-radius: 12px; background: var(--nfs-surface); }
.nfs-product img { display: block; width: 100%; aspect-ratio: 1; object-fit: contain; border-radius: 8px; background: white; }
.nfs-product h3 { margin: 12px 0 8px !important; font-size: .88rem !important; line-height: 1.35 !important; font-family: ui-sans-serif, sans-serif !important; }
.nfs-product__price { font-size: .86rem; font-weight: 800; }
.nfs-product__cta { margin-top: 10px; display: inline-flex; min-height: 38px; align-items: center; justify-content: center; width: 100%; border-radius: 8px; background: var(--nfs-green); color: #fff; text-decoration: none; font-size: .78rem; font-weight: 800; }
.nfs-product__cta:hover { color: #fff; background: var(--nfs-green-dark); }

.nfs-author-area { width: min(calc(100% - 40px), 760px); margin: 56px auto 0; }
.nfs-person-card { padding: 24px; border-top: 1px solid var(--nfs-border); display: grid; grid-template-columns: 72px 1fr; gap: 18px; }
.nfs-person-card img { width: 72px; height: 72px; object-fit: cover; border-radius: 50%; }
.nfs-person-card__placeholder { width: 72px; height: 72px; display: grid; place-items: center; border-radius: 50%; background: var(--nfs-green-soft); color: var(--nfs-green-dark); font-size: 1.35rem; font-weight: 850; }
.nfs-person-card h2, .nfs-person-card h3 { margin: 0; font-size: 1rem; }
.nfs-person-card p { margin: 6px 0 0; color: var(--nfs-muted); font-size: .84rem; line-height: 1.55; }
.nfs-person-card__role { display: block; margin-bottom: 4px; color: var(--nfs-green); font-size: .68rem; font-weight: 800; text-transform: uppercase; letter-spacing: .07em; }
.nfs-related { margin-top: 58px; padding: 58px 0 76px; background: var(--nfs-surface); border-top: 1px solid var(--nfs-border); }

/* Pages, search, author */
.nfs-page { padding: 54px 0 80px; }
.nfs-page-header { width: min(calc(100% - 40px), 860px); margin: 0 auto 34px; }
.nfs-page-header h1 { margin: 0; font-family: var(--nfs-heading-font); font-size: clamp(2.25rem, 4.6vw, var(--nfs-h1-size)); line-height: 1.03; letter-spacing: -.045em; }
.nfs-page-content { width: min(calc(100% - 40px), 760px); margin-inline: auto; }
.nfs-search-heading { margin-bottom: 28px; }
.nfs-search-group { margin-top: 48px; }
.nfs-search-group > h2 { padding-bottom: 12px; border-bottom: 1px solid var(--nfs-border); font-family: Georgia, serif; font-size: 1.8rem; }
.nfs-empty { padding: 48px 0 80px; }
.nfs-empty h2 { font-family: Georgia, serif; font-size: 2rem; }

/* Directory */
.nfs-directory-intro { width: min(calc(100% - 40px), 880px); margin: 0 auto 34px; }
.nfs-alpha-nav { display: flex; gap: 5px; flex-wrap: wrap; margin: 24px 0; }
.nfs-alpha-nav a { min-width: 36px; height: 36px; display: grid; place-items: center; border: 1px solid var(--nfs-border); border-radius: 8px; background: var(--nfs-surface); text-decoration: none; font-weight: 800; font-size: .8rem; }
.nfs-alpha-section { display: grid; grid-template-columns: 64px 1fr; gap: 20px; padding: 30px 0; border-top: 1px solid var(--nfs-border); }
.nfs-alpha-letter { font-family: Georgia, serif; font-size: 2.6rem; color: var(--nfs-green); line-height: 1; }
.nfs-alpha-list { display: grid; grid-template-columns: repeat(3,minmax(0,1fr)); gap: 8px 24px; }
.nfs-alpha-list a { text-decoration: none; color: var(--nfs-ink); font-weight: 650; font-size: .9rem; }
.nfs-alpha-list a:hover { color: var(--nfs-green); }

/* Footer */
.site-footer { background: var(--nfs-green-dark); color: #e9f0ea; padding: 58px 0 26px; }
.site-footer a { color: #f1f5ef; }
.nfs-footer-grid { display: grid; grid-template-columns: 1.35fr repeat(3, 1fr); gap: 48px; }
.nfs-footer-brand { max-width: 370px; }
.nfs-footer-brand .nfs-wordmark { color: #fff; }
.nfs-footer-brand p { margin: 16px 0 0; color: #c5d2c8; font-size: .86rem; line-height: 1.65; }
.nfs-footer-col h2 { margin: 0 0 12px; font-size: .77rem; text-transform: uppercase; letter-spacing: .09em; color: #a9bbaE; }
.nfs-footer-col ul { list-style: none; margin: 0; padding: 0; }
.nfs-footer-col li { margin: 8px 0; }
.nfs-footer-col a { text-decoration: none; font-size: .86rem; }
.nfs-footer-legal { margin-top: 44px; padding-top: 22px; border-top: 1px solid rgba(255,255,255,.16); display: flex; justify-content: space-between; gap: 26px; color: #b9c7bd; font-size: .75rem; }
.nfs-footer-legal p { margin: 0; max-width: 760px; }

/* Comments */
.comments-area { width: min(calc(100% - 40px), 760px); margin: 58px auto; }
.comment-list { padding: 0; list-style: none; }
.comment-body { padding: 18px 0; border-bottom: 1px solid var(--nfs-border); }
.comment-meta { font-size: .82rem; }
.comment-content { font-family: Georgia, serif; }
.comment-form input:not([type="submit"]), .comment-form textarea { width: 100%; padding: 12px; border: 1px solid var(--nfs-border); border-radius: 8px; background: var(--nfs-surface); }
.form-submit input { border: 0; padding: 11px 18px; border-radius: 8px; background: var(--nfs-green); color: #fff; font-weight: 800; }

/* Accessibility and utility */
.skip-link { position: absolute; top: -60px; left: 10px; z-index: 999; background: #fff; color: var(--nfs-ink); padding: 10px 14px; border-radius: 6px; }
.skip-link:focus { top: 10px; }

@media (max-width: 1040px) {
  .nfs-primary-nav { display: none; position: absolute; top: var(--nfs-header-h); left: 0; right: 0; padding: 12px 20px 20px; background: var(--nfs-bg); border-bottom: 1px solid var(--nfs-border); }
  .nfs-primary-nav.is-open { display: block; }
  .nfs-primary-nav ul { display: block; }
  .nfs-primary-nav a { padding: 12px 8px; }
  .nfs-menu-toggle { display: inline-grid; }
  .nfs-header-actions { margin-left: auto; }
  .nfs-topic-grid { grid-template-columns: repeat(3,1fr); }
  .nfs-article-layout { grid-template-columns: minmax(0,1fr); width: min(calc(100% - 40px), 760px); gap: 28px; }
  .nfs-article-sidebar { position: static; order: -1; }
  .nfs-toc ol { columns: 2; column-gap: 30px; }
  .nfs-footer-grid { grid-template-columns: 1.2fr 1fr 1fr; }
  .nfs-footer-brand { grid-column: 1 / -1; }
}

@media (max-width: 760px) {
  :root { --nfs-header-h: 62px; }
  body { font-size: 16px; }
  .admin-bar .site-header { top: 46px; }
  .nfs-shell, .nfs-content-width { width: min(calc(100% - 30px), var(--nfs-wide)); }
  .nfs-header-inner { min-height: var(--nfs-header-h); gap: 10px; }
  .custom-logo { max-height: 38px; }
  .nfs-wordmark { font-size: 1rem; }
  .nfs-wordmark svg { width: 28px; height: 28px; }
  .nfs-icon-button { width: 40px; height: 40px; }
  .nfs-home-hero { padding-top: 48px; }
  .nfs-home-hero__grid { grid-template-columns: 1fr; }
  .nfs-home-hero h1 { font-size: clamp(2.15rem, 10vw, var(--nfs-h1-size)); }
  .nfs-hero-orbit { display: none; }
  .nfs-search-form { gap: 6px; }
  .nfs-home-search button, .nfs-search-form button { min-width: auto; padding: 0 14px; }
  .nfs-section-head { display: block; }
  .nfs-section-link { display: inline-block; margin-top: 14px; }
  .nfs-topic-grid { grid-template-columns: repeat(2,1fr); }
  .nfs-topic-card { min-height: 150px; padding: 18px; }
  .nfs-topic-icon { margin-bottom: 20px; }
  .nfs-goal-grid { grid-template-columns: repeat(2,1fr); }
  .nfs-card-grid { grid-template-columns: 1fr; gap: 36px; }
  .nfs-card--featured { grid-template-columns: 1fr; gap: 16px; }
  .nfs-card--featured h2 { font-size: 2rem; }
  .nfs-article-header__inner { width: calc(100% - 30px); }
  .nfs-article-hero { width: min(calc(100% - 30px), 1080px); }
  .nfs-article-hero img, .nfs-article-hero figcaption { width: 100%; }
  .nfs-article-header h1 { font-size: clamp(2.1rem, 9.5vw, var(--nfs-h1-size)); }
  .nfs-article-layout { width: calc(100% - 30px); margin-top: 28px; }
  .entry-content { font-size: var(--nfs-content-size); line-height: var(--nfs-content-line-height); }
  .entry-content h2 { margin-top: 1.8em; }
  .entry-content table { display: block; overflow-x: auto; white-space: nowrap; }
  .nfs-key-facts dl { grid-template-columns: 1fr; }
  .nfs-toc ol { columns: 1; }
  .nfs-products { grid-template-columns: 1fr; }
  .nfs-alpha-section { grid-template-columns: 44px 1fr; }
  .nfs-alpha-list { grid-template-columns: repeat(2,minmax(0,1fr)); }
  .nfs-footer-grid { grid-template-columns: 1fr 1fr; gap: 30px; }
  .nfs-footer-brand { grid-column: 1 / -1; }
  .nfs-footer-legal { display: block; }
  .nfs-footer-legal p + p { margin-top: 12px; }
}

@media (max-width: 480px) {
  .nfs-header-actions .nfs-search-toggle { display: none; }
  .nfs-topic-grid, .nfs-goal-grid, .nfs-footer-grid { grid-template-columns: 1fr; }
  .nfs-alpha-list { grid-template-columns: 1fr; }
  .nfs-person-card { grid-template-columns: 52px 1fr; padding-inline: 0; }
  .nfs-person-card img, .nfs-person-card__placeholder { width: 52px; height: 52px; }
}

@media (prefers-reduced-motion: reduce) {
  *, *::before, *::after { scroll-behavior: auto !important; transition: none !important; animation: none !important; }
}

@media print {
  .site-header, .site-footer, .nfs-article-sidebar, .nfs-related, .comments-area, .nfs-affiliate-slot { display: none !important; }
  body { background: #fff; color: #000; }
  .nfs-article-layout { display: block; width: 100%; }
  .entry-content { font-size: 11pt; }
}

.nfs-reviewer-profile { display: grid; grid-template-columns: 180px minmax(0,1fr); gap: 30px; align-items: start; }
.nfs-reviewer-photo img { display: block; width: 180px; aspect-ratio: 1; object-fit: cover; border-radius: 50%; }
@media (max-width: 640px) { .nfs-reviewer-profile { grid-template-columns: 1fr; } .nfs-reviewer-photo img { width: 120px; } }